C22H26N2O7 — CID 21203784
2-[1,4-bis(2,5-dimethoxyphenyl)-3-oxopiperazin-2-yl]acetic acid (PubChem CID 21203784) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-[1,4-bis(2,5-dimethoxyphenyl)-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1,4-bis(2,5-dimethoxyphenyl)-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 21203784 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-[1,4-bis(2,5-dimethoxyphenyl)-3-oxopiperazin-2-yl]acetic acid |
| SMILES | COc1ccc(OC)c(N2CCN(c3cc(OC)ccc3OC)C(CC(=O)O)C2=O)c1 |
| InChI | InChI=1S/C22H26N2O7/c1-28-14-5-7-19(30-3)16(11-14)23-9-10-24(22(27)18(23)13-21(25)26)17-12-15(29-2)6-8-20(17)31-4/h5-8,11-12,18H,9-10,13H2,1-4H3,(H,25,26) |
| InChIKey | NWWMZEFVSBTFGU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |