C21H14BrClN3O3+ — CID 21205476
2-[6-bromo-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]-1-(4-chlorophenyl)ethanone (PubChem CID 21205476) has the molecular formula C21H14BrClN3O3+ and a molecular weight of 471.72 g/mol. Its IUPAC name is 2-[6-bromo-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]-1-(4-chlorophenyl)ethanone.
| Compound Name | 2-[6-bromo-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]-1-(4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 21205476 |
| Molecular Formula | C21H14BrClN3O3+ |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | 2-[6-bromo-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]-1-(4-chlorophenyl)ethanone |
| SMILES | O=C(Cn1c(-c2ccc([N+](=O)[O-])cc2)c[n+]2cc(Br)ccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14BrClN3O3/c22-16-5-10-21-24(11-16)12-19(14-3-8-18(9-4-14)26(28)29)25(21)13-20(27)15-1-6-17(23)7-2-15/h1-12H,13H2/q+1 |
| InChIKey | HSNLOIZIPFNTRV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 69.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|