C22H22N4O2S — CID 21205688
N-[(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-3-yl]benzamide (PubChem CID 21205688) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | N-[(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 21205688 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-3-yl]benzamide |
| SMILES | C=CC/N=C1\S/C(=C\c2ccc(N(C)C)cc2)C(=O)N1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-4-14-23-22-26(24-20(27)17-8-6-5-7-9-17)21(28)19(29-22)15-16-10-12-18(13-11-16)25(2)3/h4-13,15H,1,14H2,2-3H3,(H,24,27)/b19-15-,23-22- |
| InChIKey | AFMJMDMILFZGKH-YLOFGMNHSA-N |
| XLogP | 3.56 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|