C11H23NO7S2 — CID 21206503
4-(1-methylpiperidin-1-ium-1-yl)-1,1-dioxothiolan-3-ol;methyl sulfate (PubChem CID 21206503) has the molecular formula C11H23NO7S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-(1-methylpiperidin-1-ium-1-yl)-1,1-dioxothiolan-3-ol;methyl sulfate.
| Compound Name | 4-(1-methylpiperidin-1-ium-1-yl)-1,1-dioxothiolan-3-ol;methyl sulfate |
|---|---|
| PubChem CID | 21206503 |
| Molecular Formula | C11H23NO7S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 4-(1-methylpiperidin-1-ium-1-yl)-1,1-dioxothiolan-3-ol;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[N+]1(C2CS(=O)(=O)CC2O)CCCCC1 |
| InChI | InChI=1S/C10H20NO3S.CH4O4S/c1-11(5-3-2-4-6-11)9-7-15(13,14)8-10(9)12;1-5-6(2,3)4/h9-10,12H,2-8H2,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | GQICPBBZMCDNOU-UHFFFAOYSA-M |
| XLogP | -1.13 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|