C22H30NO6P — CID 21210999
methyl 4-[[di(propan-2-yloxy)phosphoryl-(2-methoxyphenyl)methyl]amino]benzoate (PubChem CID 21210999) has the molecular formula C22H30NO6P and a molecular weight of 435.46 g/mol. Its IUPAC name is methyl 4-[[di(propan-2-yloxy)phosphoryl-(2-methoxyphenyl)methyl]amino]benzoate.
| Compound Name | methyl 4-[[di(propan-2-yloxy)phosphoryl-(2-methoxyphenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 21210999 |
| Molecular Formula | C22H30NO6P |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | methyl 4-[[di(propan-2-yloxy)phosphoryl-(2-methoxyphenyl)methyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(c2ccccc2OC)P(=O)(OC(C)C)OC(C)C)cc1 |
| InChI | InChI=1S/C22H30NO6P/c1-15(2)28-30(25,29-16(3)4)21(19-9-7-8-10-20(19)26-5)23-18-13-11-17(12-14-18)22(24)27-6/h7-16,21,23H,1-6H3 |
| InChIKey | LPRLNOPAMRXWPN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|