C20H17BrO3 — CID 21211267
2-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)benzaldehyde (PubChem CID 21211267) has the molecular formula C20H17BrO3 and a molecular weight of 385.26 g/mol. Its IUPAC name is 2-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)benzaldehyde.
| Compound Name | 2-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 21211267 |
| Molecular Formula | C20H17BrO3 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)benzaldehyde |
| SMILES | CCOc1cc(C=O)c(Br)cc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H17BrO3/c1-2-23-19-10-16(12-22)18(21)11-20(19)24-13-15-8-5-7-14-6-3-4-9-17(14)15/h3-12H,2,13H2,1H3 |
| InChIKey | CYEFLMHOMKHUOR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|