C21H12N4O4S — CID 21211433
(2E)-2-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 21211433) has the molecular formula C21H12N4O4S and a molecular weight of 416.42 g/mol. Its IUPAC name is (2E)-2-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2E)-2-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 21211433 |
| Molecular Formula | C21H12N4O4S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | (2E)-2-[[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | O=c1/c(=C\c2ccc(Oc3ccc([N+](=O)[O-])cn3)cc2)sc2nc3ccccc3n12 |
| InChI | InChI=1S/C21H12N4O4S/c26-20-18(30-21-23-16-3-1-2-4-17(16)24(20)21)11-13-5-8-15(9-6-13)29-19-10-7-14(12-22-19)25(27)28/h1-12H/b18-11+ |
| InChIKey | HYESQVDBEHAVEI-WOJGMQOQSA-N |
| XLogP | 3.55 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|