C23H23N5OS — CID 21212411
2-[[5-(4-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethanone (PubChem CID 21212411) has the molecular formula C23H23N5OS and a molecular weight of 417.54 g/mol. Its IUPAC name is 2-[[5-(4-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethanone.
| Compound Name | 2-[[5-(4-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethanone |
|---|---|
| PubChem CID | 21212411 |
| Molecular Formula | C23H23N5OS |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 2-[[5-(4-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethanone |
| SMILES | Cn1c(SCC(=O)n2c3c(c4ccccc42)CCCC3)nnc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C23H23N5OS/c1-27-22(15-10-12-16(24)13-11-15)25-26-23(27)30-14-21(29)28-19-8-4-2-6-17(19)18-7-3-5-9-20(18)28/h2,4,6,8,10-13H,3,5,7,9,14,24H2,1H3 |
| InChIKey | PNIYAFHWAJURPB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|