C24H26N4OS — CID 28913778
(1S)-2-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethanol (PubChem CID 28913778) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is (1S)-2-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethanol.
| Compound Name | (1S)-2-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethanol |
|---|---|
| PubChem CID | 28913778 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (1S)-2-[[4-methyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethanol |
| SMILES | Cc1ccc(-c2nnc(SC[C@H](O)n3c4c(c5ccccc53)CCCC4)n2C)cc1 |
| InChI | InChI=1S/C24H26N4OS/c1-16-11-13-17(14-12-16)23-25-26-24(27(23)2)30-15-22(29)28-20-9-5-3-7-18(20)19-8-4-6-10-21(19)28/h3,5,7,9,11-14,22,29H,4,6,8,10,15H2,1-2H3/t22-/m0/s1 |
| InChIKey | JSPRVLFLUBFJTJ-QFIPXVFZSA-N |
| XLogP | 4.91 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |