C17H11BrCl2O3 — CID 2121650
6-bromo-2-[(2,4-dichlorophenoxy)methyl]-3-methylchromen-4-one (PubChem CID 2121650) has the molecular formula C17H11BrCl2O3 and a molecular weight of 414.08 g/mol. Its IUPAC name is 6-bromo-2-[(2,4-dichlorophenoxy)methyl]-3-methylchromen-4-one.
| Compound Name | 6-bromo-2-[(2,4-dichlorophenoxy)methyl]-3-methylchromen-4-one |
|---|---|
| PubChem CID | 2121650 |
| Molecular Formula | C17H11BrCl2O3 |
| Molecular Weight | 414.08 g/mol |
| Exact Mass | 411.93 |
| IUPAC Name | 6-bromo-2-[(2,4-dichlorophenoxy)methyl]-3-methylchromen-4-one |
| SMILES | Cc1c(COc2ccc(Cl)cc2Cl)oc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C17H11BrCl2O3/c1-9-16(8-22-15-5-3-11(19)7-13(15)20)23-14-4-2-10(18)6-12(14)17(9)21/h2-7H,8H2,1H3 |
| InChIKey | JKZHTJXAZOFZBM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.08 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |