C15H30N2 — CID 21217082
N-cyclohexyl-2,2,6,6-tetramethylpiperidin-1-amine (PubChem CID 21217082) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is N-cyclohexyl-2,2,6,6-tetramethylpiperidin-1-amine.
| Compound Name | N-cyclohexyl-2,2,6,6-tetramethylpiperidin-1-amine |
|---|---|
| PubChem CID | 21217082 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | N-cyclohexyl-2,2,6,6-tetramethylpiperidin-1-amine |
| SMILES | CC1(C)CCCC(C)(C)N1NC1CCCCC1 |
| InChI | InChI=1S/C15H30N2/c1-14(2)11-8-12-15(3,4)17(14)16-13-9-6-5-7-10-13/h13,16H,5-12H2,1-4H3 |
| InChIKey | UKMSAMOACBYUAA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |