C24H50N4 — CID 15170021
N,N'-bis(2,2,6,6-tetramethylpiperidin-1-yl)hexane-1,6-diamine (PubChem CID 15170021) has the molecular formula C24H50N4 and a molecular weight of 394.69 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylpiperidin-1-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-1-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 15170021 |
| Molecular Formula | C24H50N4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.40 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-1-yl)hexane-1,6-diamine |
| SMILES | CC1(C)CCCC(C)(C)N1NCCCCCCNN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C24H50N4/c1-21(2)15-13-16-22(3,4)27(21)25-19-11-9-10-12-20-26-28-23(5,6)17-14-18-24(28,7)8/h25-26H,9-20H2,1-8H3 |
| InChIKey | MKIAKQOUHJRYBD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|