C13H9ClF3N3O2 — CID 2121808
N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 2121808) has the molecular formula C13H9ClF3N3O2 and a molecular weight of 331.68 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 2121808 |
| Molecular Formula | C13H9ClF3N3O2 |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)ccc1=O |
| InChI | InChI=1S/C13H9ClF3N3O2/c1-20-11(21)5-4-10(19-20)12(22)18-7-2-3-9(14)8(6-7)13(15,16)17/h2-6H,1H3,(H,18,22) |
| InChIKey | BNWBLPZQPLNRFM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |