C16H14N2O3S — CID 21221412
4-[2-(4-hydroxyphenyl)pyrrol-1-yl]benzenesulfonamide (PubChem CID 21221412) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)pyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-(4-hydroxyphenyl)pyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 21221412 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)pyrrol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cccc2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C16H14N2O3S/c17-22(20,21)15-9-5-13(6-10-15)18-11-1-2-16(18)12-3-7-14(19)8-4-12/h1-11,19H,(H2,17,20,21) |
| InChIKey | PXONNSQFPKVKLY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |