C17H14F2N2O2S — CID 141086948
4-[4-(difluoromethyl)-2-phenylpyrrol-1-yl]benzenesulfonamide (PubChem CID 141086948) has the molecular formula C17H14F2N2O2S and a molecular weight of 348.37 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)-2-phenylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-(difluoromethyl)-2-phenylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 141086948 |
| Molecular Formula | C17H14F2N2O2S |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-[4-(difluoromethyl)-2-phenylpyrrol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cc(C(F)F)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H14F2N2O2S/c18-17(19)13-10-16(12-4-2-1-3-5-12)21(11-13)14-6-8-15(9-7-14)24(20,22)23/h1-11,17H,(H2,20,22,23) |
| InChIKey | YCRUDJKFQIEIII-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |