C25H29FN2O2 — CID 21221636
N-[8-(dipropylamino)-6,7,8,9-tetrahydrodibenzofuran-2-yl]-4-fluorobenzamide (PubChem CID 21221636) has the molecular formula C25H29FN2O2 and a molecular weight of 408.52 g/mol. Its IUPAC name is N-[8-(dipropylamino)-6,7,8,9-tetrahydrodibenzofuran-2-yl]-4-fluorobenzamide.
| Compound Name | N-[8-(dipropylamino)-6,7,8,9-tetrahydrodibenzofuran-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 21221636 |
| Molecular Formula | C25H29FN2O2 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[8-(dipropylamino)-6,7,8,9-tetrahydrodibenzofuran-2-yl]-4-fluorobenzamide |
| SMILES | CCCN(CCC)C1CCc2oc3ccc(NC(=O)c4ccc(F)cc4)cc3c2C1 |
| InChI | InChI=1S/C25H29FN2O2/c1-3-13-28(14-4-2)20-10-12-24-22(16-20)21-15-19(9-11-23(21)30-24)27-25(29)17-5-7-18(26)8-6-17/h5-9,11,15,20H,3-4,10,12-14,16H2,1-2H3,(H,27,29) |
| InChIKey | WIKVZOREYCXKRI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |