C21H14ClNO4 — CID 21229558
(5Z)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-(3-methoxyphenyl)-1,3-oxazol-4-one (PubChem CID 21229558) has the molecular formula C21H14ClNO4 and a molecular weight of 379.80 g/mol. Its IUPAC name is (5Z)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-(3-methoxyphenyl)-1,3-oxazol-4-one.
| Compound Name | (5Z)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-(3-methoxyphenyl)-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 21229558 |
| Molecular Formula | C21H14ClNO4 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (5Z)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-(3-methoxyphenyl)-1,3-oxazol-4-one |
| SMILES | COc1cccc(C2=NC(=O)/C(=C/c3ccc(-c4ccccc4Cl)o3)O2)c1 |
| InChI | InChI=1S/C21H14ClNO4/c1-25-14-6-4-5-13(11-14)21-23-20(24)19(27-21)12-15-9-10-18(26-15)16-7-2-3-8-17(16)22/h2-12H,1H3/b19-12- |
| InChIKey | NQUXRYJXQKAQMK-UNOMPAQXSA-N |
| XLogP | 4.95 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|