C25H18N4O2 — CID 21229816
N-[(E)-anthracen-9-ylmethylideneamino]-2-(4-oxo-3H-phthalazin-1-yl)acetamide (PubChem CID 21229816) has the molecular formula C25H18N4O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[(E)-anthracen-9-ylmethylideneamino]-2-(4-oxo-3H-phthalazin-1-yl)acetamide.
| Compound Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 21229816 |
| Molecular Formula | C25H18N4O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)N/N=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C25H18N4O2/c30-24(14-23-20-11-5-6-12-21(20)25(31)29-27-23)28-26-15-22-18-9-3-1-7-16(18)13-17-8-2-4-10-19(17)22/h1-13,15H,14H2,(H,28,30)(H,29,31)/b26-15+ |
| InChIKey | TVJFXECRBSBMTC-CVKSISIWSA-N |
| XLogP | 3.92 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|