C15H11F2N5O — CID 21230348
5-amino-3-[(Z)-1-cyano-2-(2,4-difluorophenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile (PubChem CID 21230348) has the molecular formula C15H11F2N5O and a molecular weight of 315.28 g/mol. Its IUPAC name is 5-amino-3-[(Z)-1-cyano-2-(2,4-difluorophenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(Z)-1-cyano-2-(2,4-difluorophenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 21230348 |
| Molecular Formula | C15H11F2N5O |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 5-amino-3-[(Z)-1-cyano-2-(2,4-difluorophenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
| SMILES | N#C/C(=C\c1ccc(F)cc1F)c1nn(CCO)c(N)c1C#N |
| InChI | InChI=1S/C15H11F2N5O/c16-11-2-1-9(13(17)6-11)5-10(7-18)14-12(8-19)15(20)22(21-14)3-4-23/h1-2,5-6,23H,3-4,20H2/b10-5+ |
| InChIKey | APEPJCRBUYBCOB-BJMVGYQFSA-N |
| XLogP | 1.67 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|