C19H15N5O — CID 2851332
5-amino-3-(1-cyano-2-naphthalen-1-ylethenyl)-1-(2-hydroxyethyl)pyrazole-4-carbonitrile (PubChem CID 2851332) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is 5-amino-3-(1-cyano-2-naphthalen-1-ylethenyl)-1-(2-hydroxyethyl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(1-cyano-2-naphthalen-1-ylethenyl)-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 2851332 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 5-amino-3-(1-cyano-2-naphthalen-1-ylethenyl)-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
| SMILES | N#CC(=Cc1cccc2ccccc12)c1nn(CCO)c(N)c1C#N |
| InChI | InChI=1S/C19H15N5O/c20-11-15(18-17(12-21)19(22)24(23-18)8-9-25)10-14-6-3-5-13-4-1-2-7-16(13)14/h1-7,10,25H,8-9,22H2 |
| InChIKey | ACYKMQHFKZVFEB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|