C13H11N5O2 — CID 56687805
5-amino-3-[(Z)-2-cyano-2-(furan-2-yl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile (PubChem CID 56687805) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 5-amino-3-[(Z)-2-cyano-2-(furan-2-yl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(Z)-2-cyano-2-(furan-2-yl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 56687805 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-amino-3-[(Z)-2-cyano-2-(furan-2-yl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
| SMILES | N#C/C(=C/c1nn(CCO)c(N)c1C#N)c1ccco1 |
| InChI | InChI=1S/C13H11N5O2/c14-7-9(12-2-1-5-20-12)6-11-10(8-15)13(16)18(17-11)3-4-19/h1-2,5-6,19H,3-4,16H2/b9-6- |
| InChIKey | FCDXDKVPVSXBQM-TWGQIWQCSA-N |
| XLogP | 0.99 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|