C18H17F3N4OS — CID 21234186
N-(cyclopentylideneamino)-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 21234186) has the molecular formula C18H17F3N4OS and a molecular weight of 394.42 g/mol. Its IUPAC name is N-(cyclopentylideneamino)-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(cyclopentylideneamino)-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 21234186 |
| Molecular Formula | C18H17F3N4OS |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(cyclopentylideneamino)-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)cc(C(F)(F)F)n1)NN=C1CCCC1 |
| InChI | InChI=1S/C18H17F3N4OS/c19-18(20,21)15-10-14(12-6-2-1-3-7-12)22-17(23-15)27-11-16(26)25-24-13-8-4-5-9-13/h1-3,6-7,10H,4-5,8-9,11H2,(H,25,26) |
| InChIKey | BKMRBSIPRDZJNC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|