C13H18F3NO3 — CID 21234978
ethyl (Z)-3-piperidin-1-yl-2-(2,2,2-trifluoroacetyl)but-2-enoate (PubChem CID 21234978) has the molecular formula C13H18F3NO3 and a molecular weight of 293.28 g/mol. Its IUPAC name is ethyl (Z)-3-piperidin-1-yl-2-(2,2,2-trifluoroacetyl)but-2-enoate.
| Compound Name | ethyl (Z)-3-piperidin-1-yl-2-(2,2,2-trifluoroacetyl)but-2-enoate |
|---|---|
| PubChem CID | 21234978 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethyl (Z)-3-piperidin-1-yl-2-(2,2,2-trifluoroacetyl)but-2-enoate |
| SMILES | CCOC(=O)/C(C(=O)C(F)(F)F)=C(/C)N1CCCCC1 |
| InChI | InChI=1S/C13H18F3NO3/c1-3-20-12(19)10(11(18)13(14,15)16)9(2)17-7-5-4-6-8-17/h3-8H2,1-2H3/b10-9- |
| InChIKey | JVQQJVTXZZXUIZ-KTKRTIGZSA-N |
| XLogP | 2.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|