C18H18N2O — CID 21235336
(E)-4-(5,10-dimethylphenazin-2-yl)but-3-en-2-one (PubChem CID 21235336) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is (E)-4-(5,10-dimethylphenazin-2-yl)but-3-en-2-one.
| Compound Name | (E)-4-(5,10-dimethylphenazin-2-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 21235336 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (E)-4-(5,10-dimethylphenazin-2-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc2c(c1)N(C)c1ccccc1N2C |
| InChI | InChI=1S/C18H18N2O/c1-13(21)8-9-14-10-11-17-18(12-14)20(3)16-7-5-4-6-15(16)19(17)2/h4-12H,1-3H3/b9-8+ |
| InChIKey | CMXRYTARZPEKJJ-CMDGGOBGSA-N |
| XLogP | 4.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|