About [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate
[2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate (PubChem CID 21236014) has the molecular formula C24H22ClNO3
and a molecular weight of 407.90 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate.
Molecular Properties
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate |
| PubChem CID | 21236014 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate |
| SMILES | O=C(CN(Cc1ccccc1)Cc1ccccc1)OCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClNO3/c25-22-13-11-21(12-14-22)23(27)18-29-24(28)17-26(15-19-7-3-1-4-8-19)16-20-9-5-2-6-10-20/h1-14H,15-18H2 |
| InChIKey | MBEYWFYGIMRJMU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate?
The IUPAC name of [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate (CID 21236014) is [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate.
What is the SMILES notation for [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate?
The canonical SMILES for [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate is O=C(CN(Cc1ccccc1)Cc1ccccc1)OCC(=O)c1ccc(Cl)cc1.
What is the InChIKey of [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate?
The InChIKey is MBEYWFYGIMRJMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22ClNO3/c25-22-13-11-21(12-14-22)23(27)18-29-24(28)17-26(15-19-7-3-1-4-8-19)16-20-9-5-2-6-10-20/h1-14H,15-18H2.
What are the key properties of [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate?
[2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate has a molecular weight of 407.90 g/mol, XLogP of 4.77, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-chlorophenyl)-2-oxoethyl] 2-(dibenzylamino)acetate is sourced from PubChem (CID 21236014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).