C24H20N2O6S2 — CID 21236151
(NZ)-4-methoxy-N-[(4E)-4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]benzenesulfonamide (PubChem CID 21236151) has the molecular formula C24H20N2O6S2 and a molecular weight of 496.57 g/mol. Its IUPAC name is (NZ)-4-methoxy-N-[(4E)-4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]benzenesulfonamide.
| Compound Name | (NZ)-4-methoxy-N-[(4E)-4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 21236151 |
| Molecular Formula | C24H20N2O6S2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | (NZ)-4-methoxy-N-[(4E)-4-(4-methoxyphenyl)sulfonyliminonaphthalen-1-ylidene]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)/N=C2/C=C/C(=N\S(=O)(=O)c3ccc(OC)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H20N2O6S2/c1-31-17-7-11-19(12-8-17)33(27,28)25-23-15-16-24(22-6-4-3-5-21(22)23)26-34(29,30)20-13-9-18(32-2)10-14-20/h3-16H,1-2H3/b25-23-,26-24+ |
| InChIKey | FOPMDVOQQAUJLW-MJPLYFDISA-N |
| XLogP | 3.63 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|