C21H20N4O7 — CID 21236248
N,N'-bis(furan-2-ylmethyl)-2-[(4-methoxy-2-nitroanilino)methylidene]propanediamide (PubChem CID 21236248) has the molecular formula C21H20N4O7 and a molecular weight of 440.41 g/mol. Its IUPAC name is N,N'-bis(furan-2-ylmethyl)-2-[(4-methoxy-2-nitroanilino)methylidene]propanediamide.
| Compound Name | N,N'-bis(furan-2-ylmethyl)-2-[(4-methoxy-2-nitroanilino)methylidene]propanediamide |
|---|---|
| PubChem CID | 21236248 |
| Molecular Formula | C21H20N4O7 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N,N'-bis(furan-2-ylmethyl)-2-[(4-methoxy-2-nitroanilino)methylidene]propanediamide |
| SMILES | COc1ccc(NC=C(C(=O)NCc2ccco2)C(=O)NCc2ccco2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20N4O7/c1-30-14-6-7-18(19(10-14)25(28)29)22-13-17(20(26)23-11-15-4-2-8-31-15)21(27)24-12-16-5-3-9-32-16/h2-10,13,22H,11-12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | BDILREKANJKYLE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 148.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|