C22H19N3O4 — CID 21237112
6-methyl-5-nitro-4-(2-phenylmethoxynaphthalen-1-yl)-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 21237112) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 6-methyl-5-nitro-4-(2-phenylmethoxynaphthalen-1-yl)-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 6-methyl-5-nitro-4-(2-phenylmethoxynaphthalen-1-yl)-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 21237112 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 6-methyl-5-nitro-4-(2-phenylmethoxynaphthalen-1-yl)-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CC1=C([N+](=O)[O-])C(c2c(OCc3ccccc3)ccc3ccccc23)NC(=O)N1 |
| InChI | InChI=1S/C22H19N3O4/c1-14-21(25(27)28)20(24-22(26)23-14)19-17-10-6-5-9-16(17)11-12-18(19)29-13-15-7-3-2-4-8-15/h2-12,20H,13H2,1H3,(H2,23,24,26) |
| InChIKey | SETRFHOAFLSJID-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|