C31H43Cl2N3O4-2 — CID 21237516
2-[2-[4-[3-(4-tert-butylcyclohexyl)oxy-2-hydroxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione dichloride (PubChem CID 21237516) has the molecular formula C31H43Cl2N3O4-2 and a molecular weight of 592.61 g/mol. Its IUPAC name is 2-[2-[4-[3-(4-tert-butylcyclohexyl)oxy-2-hydroxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione dichloride.
| Compound Name | 2-[2-[4-[3-(4-tert-butylcyclohexyl)oxy-2-hydroxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione dichloride |
|---|---|
| PubChem CID | 21237516 |
| Molecular Formula | C31H43Cl2N3O4-2 |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 2-[2-[4-[3-(4-tert-butylcyclohexyl)oxy-2-hydroxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione dichloride |
| SMILES | CC(C)(C)C1CCC(OCC(O)CN2CCN(CCN3C(=O)c4cccc5cccc(c45)C3=O)CC2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C31H43N3O4.2ClH/c1-31(2,3)23-10-12-25(13-11-23)38-21-24(35)20-33-16-14-32(15-17-33)18-19-34-29(36)26-8-4-6-22-7-5-9-27(28(22)26)30(34)37;;/h4-9,23-25,35H,10-21H2,1-3H3;2*1H/p-2 |
| InChIKey | HCVMFIDJIRYNMJ-UHFFFAOYSA-L |
| XLogP | -1.96 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|