C29H35N3O4 — CID 30726265
2-[2-[4-[(2S)-3-(1-ethynylcyclohexyl)oxy-2-hydroxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 30726265) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[2-[4-[(2S)-3-(1-ethynylcyclohexyl)oxy-2-hydroxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[4-[(2S)-3-(1-ethynylcyclohexyl)oxy-2-hydroxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 30726265 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-[2-[4-[(2S)-3-(1-ethynylcyclohexyl)oxy-2-hydroxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | C#CC1(OC[C@@H](O)CN2CCN(CCN3C(=O)c4cccc5cccc(c45)C3=O)CC2)CCCCC1 |
| InChI | InChI=1S/C29H35N3O4/c1-2-29(12-4-3-5-13-29)36-21-23(33)20-31-16-14-30(15-17-31)18-19-32-27(34)24-10-6-8-22-9-7-11-25(26(22)24)28(32)35/h1,6-11,23,33H,3-5,12-21H2/t23-/m0/s1 |
| InChIKey | MNYVWKHKCGOJOS-QHCPKHFHSA-N |
| XLogP | 2.77 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|