C12H11N5O5 — CID 21238738
3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-(4-nitrophenyl)propanamide (PubChem CID 21238738) has the molecular formula C12H11N5O5 and a molecular weight of 305.25 g/mol. Its IUPAC name is 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-(4-nitrophenyl)propanamide.
| Compound Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 21238738 |
| Molecular Formula | C12H11N5O5 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-(4-nitrophenyl)propanamide |
| SMILES | O=C(CCc1n[nH]c(=O)[nH]c1=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H11N5O5/c18-10(6-5-9-11(19)14-12(20)16-15-9)13-7-1-3-8(4-2-7)17(21)22/h1-4H,5-6H2,(H,13,18)(H2,14,16,19,20) |
| InChIKey | ZMZIACYXZNZBBY-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|