C22H26N5O7PS2 — CID 21238898
N-bis[2-(4-methylphenyl)sulfonylhydrazinyl]phosphoryl-3-methoxybenzamide (PubChem CID 21238898) has the molecular formula C22H26N5O7PS2 and a molecular weight of 567.59 g/mol. Its IUPAC name is N-bis[2-(4-methylphenyl)sulfonylhydrazinyl]phosphoryl-3-methoxybenzamide.
| Compound Name | N-bis[2-(4-methylphenyl)sulfonylhydrazinyl]phosphoryl-3-methoxybenzamide |
|---|---|
| PubChem CID | 21238898 |
| Molecular Formula | C22H26N5O7PS2 |
| Molecular Weight | 567.59 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | N-bis[2-(4-methylphenyl)sulfonylhydrazinyl]phosphoryl-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NP(=O)(NNS(=O)(=O)c2ccc(C)cc2)NNS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H26N5O7PS2/c1-16-7-11-20(12-8-16)36(30,31)26-24-35(29,23-22(28)18-5-4-6-19(15-18)34-3)25-27-37(32,33)21-13-9-17(2)10-14-21/h4-15,26-27H,1-3H3,(H3,23,24,25,28,29) |
| InChIKey | CIAJMYUHIKUEMC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 171.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|