C12H15N3O3S2 — CID 21238993
[(5-ethoxycarbonyl-2,6-dimethylpyridine-3-carbonyl)amino]carbamodithioic acid (PubChem CID 21238993) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is [(5-ethoxycarbonyl-2,6-dimethylpyridine-3-carbonyl)amino]carbamodithioic acid.
| Compound Name | [(5-ethoxycarbonyl-2,6-dimethylpyridine-3-carbonyl)amino]carbamodithioic acid |
|---|---|
| PubChem CID | 21238993 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | [(5-ethoxycarbonyl-2,6-dimethylpyridine-3-carbonyl)amino]carbamodithioic acid |
| SMILES | CCOC(=O)c1cc(C(=O)NNC(=S)S)c(C)nc1C |
| InChI | InChI=1S/C12H15N3O3S2/c1-4-18-11(17)9-5-8(6(2)13-7(9)3)10(16)14-15-12(19)20/h5H,4H2,1-3H3,(H,14,16)(H2,15,19,20) |
| InChIKey | HUIIUKOKPKHBSU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|