C16H20N2 — CID 21241865
5-[(Z)-1-(2,6-dimethylphenyl)pent-2-en-3-yl]-1H-imidazole (PubChem CID 21241865) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-[(Z)-1-(2,6-dimethylphenyl)pent-2-en-3-yl]-1H-imidazole.
| Compound Name | 5-[(Z)-1-(2,6-dimethylphenyl)pent-2-en-3-yl]-1H-imidazole |
|---|---|
| PubChem CID | 21241865 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-[(Z)-1-(2,6-dimethylphenyl)pent-2-en-3-yl]-1H-imidazole |
| SMILES | CC/C(=C/Cc1c(C)cccc1C)c1cnc[nH]1 |
| InChI | InChI=1S/C16H20N2/c1-4-14(16-10-17-11-18-16)8-9-15-12(2)6-5-7-13(15)3/h5-8,10-11H,4,9H2,1-3H3,(H,17,18)/b14-8- |
| InChIKey | PSTDTGMPBKHEGJ-ZSOIEALJSA-N |
| XLogP | 4.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |