C38H34Cl2N6O3 — CID 21243173
4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2-phenylquinazoline (PubChem CID 21243173) has the molecular formula C38H34Cl2N6O3 and a molecular weight of 693.64 g/mol. Its IUPAC name is 4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2-phenylquinazoline.
| Compound Name | 4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2-phenylquinazoline |
|---|---|
| PubChem CID | 21243173 |
| Molecular Formula | C38H34Cl2N6O3 |
| Molecular Weight | 693.64 g/mol |
| Exact Mass | 692.21 |
| IUPAC Name | 4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2-phenylquinazoline |
| SMILES | Clc1ccc(C2(Cn3ccnc3)OCC(COc3ccc(N4CCN(c5nc(-c6ccccc6)nc6ccccc56)CC4)cc3)O2)c(Cl)c1 |
| InChI | InChI=1S/C38H34Cl2N6O3/c39-28-10-15-33(34(40)22-28)38(25-44-17-16-41-26-44)48-24-31(49-38)23-47-30-13-11-29(12-14-30)45-18-20-46(21-19-45)37-32-8-4-5-9-35(32)42-36(43-37)27-6-2-1-3-7-27/h1-17,22,26,31H,18-21,23-25H2 |
| InChIKey | UGWPDAZHCCORBY-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 77.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.64 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|