C14H18O — CID 21247868
5-(4-propylphenyl)-3,4-dihydro-2H-pyran (PubChem CID 21247868) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-(4-propylphenyl)-3,4-dihydro-2H-pyran.
| Compound Name | 5-(4-propylphenyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 21247868 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 5-(4-propylphenyl)-3,4-dihydro-2H-pyran |
| SMILES | CCCc1ccc(C2=COCCC2)cc1 |
| InChI | InChI=1S/C14H18O/c1-2-4-12-6-8-13(9-7-12)14-5-3-10-15-11-14/h6-9,11H,2-5,10H2,1H3 |
| InChIKey | ZKHOYALYRPCHQW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |