C20H17F4N3O3 — CID 21251056
5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]pyridin-2-amine (PubChem CID 21251056) has the molecular formula C20H17F4N3O3 and a molecular weight of 423.37 g/mol. Its IUPAC name is 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]pyridin-2-amine.
| Compound Name | 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 21251056 |
| Molecular Formula | C20H17F4N3O3 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]pyridin-2-amine |
| SMILES | Nc1ccc(C(Cc2cc[n+]([O-])cc2)c2ccc(OC(F)F)c(OC(F)F)c2)cn1 |
| InChI | InChI=1S/C20H17F4N3O3/c21-19(22)29-16-3-1-13(10-17(16)30-20(23)24)15(14-2-4-18(25)26-11-14)9-12-5-7-27(28)8-6-12/h1-8,10-11,15,19-20H,9H2,(H2,25,26) |
| InChIKey | DAGCAMFZZCLQGL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|