About benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate
benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate (PubChem CID 21251925) has the molecular formula C13H14BF4N2O2-
and a molecular weight of 317.07 g/mol. Its IUPAC name is benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate.
Molecular Properties
| Compound Name | benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate |
| PubChem CID | 21251925 |
| Molecular Formula | C13H14BF4N2O2- |
| Molecular Weight | 317.07 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate |
| SMILES | CCn1ccnc1C(=O)OCc1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C13H14N2O2.BF4/c1-2-15-9-8-14-12(15)13(16)17-10-11-6-4-3-5-7-11;2-1(3,4)5/h3-9H,2,10H2,1H3;/q;-1 |
| InChIKey | LUYFRIXHAIBAKA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.07 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate?
The IUPAC name of benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate (CID 21251925) is benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate.
What is the SMILES notation for benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate?
The canonical SMILES for benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate is CCn1ccnc1C(=O)OCc1ccccc1.F[B-](F)(F)F.
What is the InChIKey of benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate?
The InChIKey is LUYFRIXHAIBAKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2.BF4/c1-2-15-9-8-14-12(15)13(16)17-10-11-6-4-3-5-7-11;2-1(3,4)5/h3-9H,2,10H2,1H3;/q;-1.
What are the key properties of benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate?
benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate has a molecular weight of 317.07 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1-ethylimidazole-2-carboxylate tetrafluoroborate is sourced from PubChem (CID 21251925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).