C14H15N5O4 — CID 129117305
benzyl N-[[2-(2-carbamoylimidazol-1-yl)acetyl]amino]carbamate (PubChem CID 129117305) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is benzyl N-[[2-(2-carbamoylimidazol-1-yl)acetyl]amino]carbamate.
| Compound Name | benzyl N-[[2-(2-carbamoylimidazol-1-yl)acetyl]amino]carbamate |
|---|---|
| PubChem CID | 129117305 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | benzyl N-[[2-(2-carbamoylimidazol-1-yl)acetyl]amino]carbamate |
| SMILES | NC(=O)c1nccn1CC(=O)NNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H15N5O4/c15-12(21)13-16-6-7-19(13)8-11(20)17-18-14(22)23-9-10-4-2-1-3-5-10/h1-7H,8-9H2,(H2,15,21)(H,17,20)(H,18,22) |
| InChIKey | DQQRBSZZAAGPLJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|