C17H20Cl2N4O3 — CID 6736639
5-phenylpentyl N-[[2-(4,5-dichloroimidazol-1-yl)acetyl]amino]carbamate (PubChem CID 6736639) has the molecular formula C17H20Cl2N4O3 and a molecular weight of 399.28 g/mol. Its IUPAC name is 5-phenylpentyl N-[[2-(4,5-dichloroimidazol-1-yl)acetyl]amino]carbamate.
| Compound Name | 5-phenylpentyl N-[[2-(4,5-dichloroimidazol-1-yl)acetyl]amino]carbamate |
|---|---|
| PubChem CID | 6736639 |
| Molecular Formula | C17H20Cl2N4O3 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 5-phenylpentyl N-[[2-(4,5-dichloroimidazol-1-yl)acetyl]amino]carbamate |
| SMILES | O=C(Cn1cnc(Cl)c1Cl)NNC(=O)OCCCCCc1ccccc1 |
| InChI | InChI=1S/C17H20Cl2N4O3/c18-15-16(19)23(12-20-15)11-14(24)21-22-17(25)26-10-6-2-5-9-13-7-3-1-4-8-13/h1,3-4,7-8,12H,2,5-6,9-11H2,(H,21,24)(H,22,25) |
| InChIKey | ZLWLPPNTKCNMAW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|