C15H16Cl2N4O3 — CID 6733411
2-(3-methylphenyl)ethyl N-[[2-(4,5-dichloroimidazol-1-yl)acetyl]amino]carbamate (PubChem CID 6733411) has the molecular formula C15H16Cl2N4O3 and a molecular weight of 371.22 g/mol. Its IUPAC name is 2-(3-methylphenyl)ethyl N-[[2-(4,5-dichloroimidazol-1-yl)acetyl]amino]carbamate.
| Compound Name | 2-(3-methylphenyl)ethyl N-[[2-(4,5-dichloroimidazol-1-yl)acetyl]amino]carbamate |
|---|---|
| PubChem CID | 6733411 |
| Molecular Formula | C15H16Cl2N4O3 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-(3-methylphenyl)ethyl N-[[2-(4,5-dichloroimidazol-1-yl)acetyl]amino]carbamate |
| SMILES | Cc1cccc(CCOC(=O)NNC(=O)Cn2cnc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N4O3/c1-10-3-2-4-11(7-10)5-6-24-15(23)20-19-12(22)8-21-9-18-13(16)14(21)17/h2-4,7,9H,5-6,8H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | BLTBKXUNLRBICS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|