C18H15ClF2N2O3 — CID 45109530
2-(3-fluorophenyl)ethyl N-[[(E)-3-(2-chloro-4-fluorophenyl)prop-2-enoyl]amino]carbamate (PubChem CID 45109530) has the molecular formula C18H15ClF2N2O3 and a molecular weight of 380.78 g/mol. Its IUPAC name is 2-(3-fluorophenyl)ethyl N-[[(E)-3-(2-chloro-4-fluorophenyl)prop-2-enoyl]amino]carbamate.
| Compound Name | 2-(3-fluorophenyl)ethyl N-[[(E)-3-(2-chloro-4-fluorophenyl)prop-2-enoyl]amino]carbamate |
|---|---|
| PubChem CID | 45109530 |
| Molecular Formula | C18H15ClF2N2O3 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-(3-fluorophenyl)ethyl N-[[(E)-3-(2-chloro-4-fluorophenyl)prop-2-enoyl]amino]carbamate |
| SMILES | O=C(/C=C/c1ccc(F)cc1Cl)NNC(=O)OCCc1cccc(F)c1 |
| InChI | InChI=1S/C18H15ClF2N2O3/c19-16-11-15(21)6-4-13(16)5-7-17(24)22-23-18(25)26-9-8-12-2-1-3-14(20)10-12/h1-7,10-11H,8-9H2,(H,22,24)(H,23,25)/b7-5+ |
| InChIKey | ZJKJFTLZUVLERJ-FNORWQNLSA-N |
| XLogP | 3.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|