C14H12Cl3FN2O3 — CID 6710989
(2,2-dichlorocyclopropyl)methyl N-[3-(2-chloro-4-fluorophenyl)prop-2-enoylamino]carbamate (PubChem CID 6710989) has the molecular formula C14H12Cl3FN2O3 and a molecular weight of 381.62 g/mol. Its IUPAC name is (2,2-dichlorocyclopropyl)methyl N-[3-(2-chloro-4-fluorophenyl)prop-2-enoylamino]carbamate.
| Compound Name | (2,2-dichlorocyclopropyl)methyl N-[3-(2-chloro-4-fluorophenyl)prop-2-enoylamino]carbamate |
|---|---|
| PubChem CID | 6710989 |
| Molecular Formula | C14H12Cl3FN2O3 |
| Molecular Weight | 381.62 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | (2,2-dichlorocyclopropyl)methyl N-[3-(2-chloro-4-fluorophenyl)prop-2-enoylamino]carbamate |
| SMILES | O=C(C=Cc1ccc(F)cc1Cl)NNC(=O)OCC1CC1(Cl)Cl |
| InChI | InChI=1S/C14H12Cl3FN2O3/c15-11-5-10(18)3-1-8(11)2-4-12(21)19-20-13(22)23-7-9-6-14(9,16)17/h1-5,9H,6-7H2,(H,19,21)(H,20,22) |
| InChIKey | OIAXZDDTKRVNHQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|