C18H13ClFNO3 — CID 11508464
(E)-3-[3-chloro-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 11508464) has the molecular formula C18H13ClFNO3 and a molecular weight of 345.76 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-chloro-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 11508464 |
| Molecular Formula | C18H13ClFNO3 |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (E)-3-[3-chloro-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(/C=C/C(=O)c2ccc(F)cc2)c(Cl)c1)NO |
| InChI | InChI=1S/C18H13ClFNO3/c19-16-11-12(2-10-18(23)21-24)1-3-13(16)6-9-17(22)14-4-7-15(20)8-5-14/h1-11,24H,(H,21,23)/b9-6+,10-2+ |
| InChIKey | IYDNSVFJWFBONA-UHUONFMHSA-N |
| XLogP | 3.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|