C20H18ClNO2 — CID 143209581
(E)-3-[3-chloro-4-[(1E)-3-(2-methylphenyl)buta-1,3-dienyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 143209581) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[(1E)-3-(2-methylphenyl)buta-1,3-dienyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-chloro-4-[(1E)-3-(2-methylphenyl)buta-1,3-dienyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 143209581 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (E)-3-[3-chloro-4-[(1E)-3-(2-methylphenyl)buta-1,3-dienyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | C=C(/C=C/c1ccc(/C=C/C(=O)NO)cc1Cl)c1ccccc1C |
| InChI | InChI=1S/C20H18ClNO2/c1-14-5-3-4-6-18(14)15(2)7-10-17-11-8-16(13-19(17)21)9-12-20(23)22-24/h3-13,24H,2H2,1H3,(H,22,23)/b10-7+,12-9+ |
| InChIKey | DSLGTFRTNQTDIW-NWABJRNTSA-N |
| XLogP | 4.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|