C20H20NO2P — CID 143209580
(E)-N-hydroxy-3-[3-methyl-4-[(E)-3-(4-methylphenyl)-3-phosphanylideneprop-1-enyl]phenyl]prop-2-enamide (PubChem CID 143209580) has the molecular formula C20H20NO2P and a molecular weight of 337.36 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[3-methyl-4-[(E)-3-(4-methylphenyl)-3-phosphanylideneprop-1-enyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[3-methyl-4-[(E)-3-(4-methylphenyl)-3-phosphanylideneprop-1-enyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 143209580 |
| Molecular Formula | C20H20NO2P |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (E)-N-hydroxy-3-[3-methyl-4-[(E)-3-(4-methylphenyl)-3-phosphanylideneprop-1-enyl]phenyl]prop-2-enamide |
| SMILES | [H]/P=C(/C=C/c1ccc(/C=C/C(=O)NO)cc1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H20NO2P/c1-14-3-7-18(8-4-14)19(24)11-10-17-9-5-16(13-15(17)2)6-12-20(22)21-23/h3-13,23-24H,1-2H3,(H,21,22)/b11-10+,12-6+ |
| InChIKey | LBLLQHATVAFGSO-XTFSJJGVSA-N |
| XLogP | 4.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|