C10H10ClNO2 — CID 24860349
(E)-3-(4-chloro-2-methylphenyl)-N-hydroxyprop-2-enamide (PubChem CID 24860349) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is (E)-3-(4-chloro-2-methylphenyl)-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-(4-chloro-2-methylphenyl)-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 24860349 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (E)-3-(4-chloro-2-methylphenyl)-N-hydroxyprop-2-enamide |
| SMILES | Cc1cc(Cl)ccc1/C=C/C(=O)NO |
| InChI | InChI=1S/C10H10ClNO2/c1-7-6-9(11)4-2-8(7)3-5-10(13)12-14/h2-6,14H,1H3,(H,12,13)/b5-3+ |
| InChIKey | UWFUNUDRGMZSCC-HWKANZROSA-N |
| XLogP | 2.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|