C9H18O5 — CID 21252463
propan-2-yl 2-[2-(2-hydroxyethoxy)ethoxy]acetate (PubChem CID 21252463) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is propan-2-yl 2-[2-(2-hydroxyethoxy)ethoxy]acetate.
| Compound Name | propan-2-yl 2-[2-(2-hydroxyethoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 21252463 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | propan-2-yl 2-[2-(2-hydroxyethoxy)ethoxy]acetate |
| SMILES | CC(C)OC(=O)COCCOCCO |
| InChI | InChI=1S/C9H18O5/c1-8(2)14-9(11)7-13-6-5-12-4-3-10/h8,10H,3-7H2,1-2H3 |
| InChIKey | WAUAMMLCNFJVHL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|