C6H11BrO5 — CID 88794483
bromo 2-[2-(2-hydroxyethoxy)ethoxy]acetate (PubChem CID 88794483) has the molecular formula C6H11BrO5 and a molecular weight of 243.05 g/mol. Its IUPAC name is bromo 2-[2-(2-hydroxyethoxy)ethoxy]acetate.
| Compound Name | bromo 2-[2-(2-hydroxyethoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 88794483 |
| Molecular Formula | C6H11BrO5 |
| Molecular Weight | 243.05 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | bromo 2-[2-(2-hydroxyethoxy)ethoxy]acetate |
| SMILES | O=C(COCCOCCO)OBr |
| InChI | InChI=1S/C6H11BrO5/c7-12-6(9)5-11-4-3-10-2-1-8/h8H,1-5H2 |
| InChIKey | LJUXWHBZPLLKHF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.05 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|