C6H7NO3 — CID 21255527
2-(1,3-oxazol-2-yl)propanoic acid (PubChem CID 21255527) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-yl)propanoic acid.
| Compound Name | 2-(1,3-oxazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 21255527 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 2-(1,3-oxazol-2-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1ncco1 |
| InChI | InChI=1S/C6H7NO3/c1-4(6(8)9)5-7-2-3-10-5/h2-4H,1H3,(H,8,9) |
| InChIKey | ZNGMBNUYNUAXFS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |